
CAS 77626-59-6
:α,5-Dimethyl-2-thiophenepropanol
Description:
α,5-Dimethyl-2-thiophenepropanol, identified by its CAS number 77626-59-6, is an organic compound characterized by its unique structure that includes a thiophene ring and a propanol group. This compound features a five-membered aromatic ring containing sulfur, which contributes to its distinct chemical properties and potential reactivity. The presence of two methyl groups at the alpha and five positions enhances its hydrophobic character and may influence its solubility in various organic solvents. Typically, compounds like this can exhibit interesting biological activities, making them of interest in fields such as pharmaceuticals and agrochemicals. The thiophene moiety often imparts electronic properties that can be beneficial in organic synthesis and materials science. Additionally, the alcohol functional group suggests potential for hydrogen bonding, which can affect its physical properties, such as boiling point and viscosity. Overall, α,5-Dimethyl-2-thiophenepropanol is a compound of interest due to its structural features and potential applications in various chemical contexts.
Formula:C9H14OS
InChI:InChI=1S/C9H14OS/c1-7(10)3-5-9-6-4-8(2)11-9/h4,6-7,10H,3,5H2,1-2H3
InChI key:InChIKey=XRZTYSVITIMMLI-UHFFFAOYSA-N
SMILES:C(CC(C)O)C=1SC(C)=CC1
Synonyms:- α,5-Dimethyl-2-thiophenepropanol
- 2-(3-Hydroxybutyl)-5-methylthiophene
- 2-Thiophenepropanol, α,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.