CymitQuimica logo

CAS 776269-51-3

:

Piperazine,2-(3-methylphenyl)-

Description:
Piperazine, 2-(3-methylphenyl)-, identified by the CAS number 776269-51-3, is a chemical compound that belongs to the piperazine family, characterized by a six-membered ring containing two nitrogen atoms. This compound features a 3-methylphenyl group attached to the piperazine ring, which contributes to its unique properties. Typically, piperazine derivatives exhibit a range of biological activities, including potential applications in pharmaceuticals, particularly as anxiolytics or antidepressants. The presence of the methyl group on the phenyl ring can influence the compound's lipophilicity and overall pharmacokinetic profile. In terms of physical properties, piperazine derivatives often display moderate solubility in water and organic solvents, which can vary based on the substituents on the piperazine ring. Additionally, the compound may exhibit basicity due to the nitrogen atoms in the piperazine ring, allowing it to form salts with acids. Overall, Piperazine, 2-(3-methylphenyl)- is of interest in medicinal chemistry for its potential therapeutic applications and its role in the development of new pharmacological agents.
Formula:C11H16N2
InChI:InChI=1S/C11H16N2/c1-9-3-2-4-10(7-9)11-8-12-5-6-13-11/h2-4,7,11-13H,5-6,8H2,1H3
InChI key:HGRYPWVHQPPINF-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=C1)C2CNCCN2
Synonyms:
  • Piperazine, 2-(3-Methylphenyl)-
Found 3 products.