CymitQuimica logo

CAS 776277-28-2

:

5-(aminomethyl)furan-2-carbonitrile

Description:
5-(Aminomethyl)furan-2-carbonitrile is an organic compound characterized by its furan ring, which is a five-membered aromatic heterocycle containing one oxygen atom. The presence of an amino group (-NH2) at the 5-position and a cyano group (-C≡N) at the 2-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its structure allows for various chemical transformations, making it a valuable intermediate in the synthesis of more complex molecules. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups. As with many nitrogen-containing compounds, it may exhibit basicity due to the amino group, influencing its behavior in chemical reactions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H6N2O
InChI:InChI=1/C6H6N2O/c7-3-5-1-2-6(4-8)9-5/h1-2H,3,7H2
SMILES:c1cc(C#N)oc1CN
Synonyms:
  • 2-Furancarbonitrile, 5-(Aminomethyl)-
  • 5-(Aminomethyl)-2-furanonitril
  • 5-(Aminomethyl)-2-Furonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.