CAS 77628-51-4

6-methylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid

Description:

6-Methylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which includes both imidazole and thiazole rings. This compound features a methyl group at the 6-position of the imidazole ring and a carboxylic acid functional group at the 5-position of the thiazole ring, contributing to its acidic properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential biological activities and roles in metabolic pathways. Its CAS number, 77628-51-4, is a unique identifier that facilitates the search for information regarding its properties, synthesis, and applications. As with many heterocycles, it may participate in various chemical reactions, making it a valuable compound for research and development in synthetic organic chemistry.

Formula: C₇H₆N₂O₂S

InChI: InChI=1/C7H6N2O2S/c1-4-5(6(10)11)9-2-3-12-7(9)8-4/h2-3H,1H3,(H,10,11)

SMILES: Cc1c(C(=O)O)n2ccsc2n1

Synonyms:

• Imidazo[2,1-B]Thiazole-5-Carboxylic Acid, 6-Methyl-

6-Methylimidazo[2,1-b]thiazole-5-carboxylic acid

CAS: 77628-51-4

Formula: C₇H₆N₂O₂S

Purity: 96%

Color and Shape: Solid

Molecular weight: 182.1997

Ref: IN-DA008OSW

6-Methylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid

CAS: 77628-51-4

6-Methylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid

Purity: ≥95%

Color and Shape: Brown Powder

Molecular weight: 182.20g/mol

Ref: 54-OR25897

6-Methylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid

CAS: 77628-51-4

Formula: C₇H₆N₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 182.2

Ref: 10-F223495