CymitQuimica logo

CAS 776281-59-5

:

2-(1H-imidazol-2-ylmethyl)guanidine

Description:
2-(1H-imidazol-2-ylmethyl)guanidine, with the CAS number 776281-59-5, is a chemical compound characterized by its unique structure that includes both imidazole and guanidine functional groups. This compound typically appears as a solid and is soluble in polar solvents, which is indicative of its potential interactions in biological systems. It is known for its role as a pharmacological agent, often studied for its potential applications in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. The presence of the imidazole ring contributes to its ability to participate in hydrogen bonding and coordination with metal ions, enhancing its reactivity and biological activity. Additionally, the guanidine moiety is associated with basicity, which can influence the compound's behavior in physiological environments. Overall, 2-(1H-imidazol-2-ylmethyl)guanidine exhibits properties that make it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C5H9N5
InChI:InChI=1/C5H9N5/c6-5(7)10-3-4-8-1-2-9-4/h1-2H,3H2,(H,8,9)(H4,6,7,10)
Synonyms:
  • guanidine, N-(1H-imidazol-2-ylmethyl)-
  • 1-(1H-imidazol-2-ylmethyl)guanidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.