CymitQuimica logo

CAS 776290-49-4

:

5-(chloromethyl)-1-isopropyl-imidazole

Description:
5-(Chloromethyl)-1-isopropyl-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a chloromethyl group (-CH2Cl) at the 5-position and an isopropyl group at the 1-position contributes to its unique reactivity and potential applications. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it useful in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The chloromethyl group can serve as a reactive site for nucleophilic substitution reactions, while the imidazole moiety can participate in coordination chemistry and biological interactions. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of chlorine and its potential reactivity. Overall, 5-(chloromethyl)-1-isopropyl-imidazole is a versatile intermediate in organic synthesis with applications in medicinal chemistry.
Formula:C7H11ClN2
InChI:InChI=1/C7H11ClN2/c1-6(2)10-5-9-4-7(10)3-8/h4-6H,3H2,1-2H3
SMILES:CC(C)n1cncc1CCl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.