CAS 776327-08-3

Methyl α-(aminomethyl)-3-fluorobenzenepropanoate

Description:

Methyl α-(aminomethyl)-3-fluorobenzenepropanoate, with the CAS number 776327-08-3, is a chemical compound that features a propanoate ester functional group, an amino group, and a fluorinated aromatic ring. This compound is characterized by its molecular structure, which includes a methyl ester group attached to a propanoic acid backbone, along with an amino group positioned on the benzene ring. The presence of the fluorine atom at the meta position of the aromatic ring can influence the compound's reactivity and physical properties, such as polarity and solubility. Methyl α-(aminomethyl)-3-fluorobenzenepropanoate may exhibit biological activity, making it of interest in pharmaceutical research and development. Its synthesis typically involves the reaction of appropriate starting materials under controlled conditions to ensure the desired functional groups are introduced correctly. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of personal protective equipment and adherence to relevant safety guidelines.

Formula: C₁₁H₁₄FNO₂

InChI: InChI=1S/C11H14FNO2/c1-15-11(14)9(7-13)5-8-3-2-4-10(12)6-8/h2-4,6,9H,5,7,13H2,1H3

InChI key: InChIKey=PCJCLTWTQHCCRS-UHFFFAOYSA-N

SMILES: C(C(C(OC)=O)CN)C1=CC(F)=CC=C1

Synonyms:

• Methyl α-(aminomethyl)-3-fluorobenzenepropanoate
• Benzenepropanoic acid, α-(aminomethyl)-3-fluoro-, methyl ester