CAS 776330-76-8

β-Aminobicyclo[2.2.1]heptane-2-propanoic acid

Description:

β-Aminobicyclo[2.2.1]heptane-2-propanoic acid, identified by its CAS number 776330-76-8, is a bicyclic compound featuring a unique structure that includes a bicyclo[2.2.1]heptane framework with an amino group and a propanoic acid moiety. This compound is characterized by its chiral centers, which contribute to its potential biological activity and interactions. It typically exhibits properties such as solubility in polar solvents, which is influenced by the presence of the carboxylic acid functional group. The amino group can participate in hydrogen bonding, enhancing its reactivity and interaction with biological systems. β-Aminobicyclo[2.2.1]heptane-2-propanoic acid may serve as a valuable intermediate in organic synthesis or as a building block in the development of pharmaceuticals, particularly in the context of drug design where bicyclic structures are often explored for their unique conformational properties. Its specific applications and behavior in chemical reactions would depend on the surrounding conditions and the presence of other functional groups.

Formula: C₁₀H₁₇NO₂

InChI: InChI=1S/C10H17NO2/c11-9(5-10(12)13)8-4-6-1-2-7(8)3-6/h6-9H,1-5,11H2,(H,12,13)

InChI key: InChIKey=LVGFIIKOBHJGDO-UHFFFAOYSA-N

SMILES: C(CC(O)=O)(N)C1C2CC(C1)CC2

Synonyms:

• β-Aminobicyclo[2.2.1]heptane-2-propanoic acid
• 3-Amino-3-[bicyclo[2.2.1]heptan-2-yl]propanoic acid
• Bicyclo[2.2.1]heptane-2-propanoic acid, β-amino-