CAS 77635-17-7

5,6,7,8-Tetrahydro-8-oxo-1-naphthalenecarboxylic acid

Description:

5,6,7,8-Tetrahydro-8-oxo-1-naphthalenecarboxylic acid is an organic compound characterized by its bicyclic structure, which includes a naphthalene ring system. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the ring, along with a ketone functional group (8-oxo) and a carboxylic acid group (carboxylic acid). The presence of these functional groups contributes to its potential reactivity and solubility in various solvents. The compound is typically a white to off-white solid and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of bioactive compounds due to the presence of the carboxylic acid, which can participate in various chemical reactions. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₁H₁₀O₃

InChI: InChI=1S/C11H10O3/c12-9-6-2-4-7-3-1-5-8(10(7)9)11(13)14/h1,3,5H,2,4,6H2,(H,13,14)

InChI key: InChIKey=PZRRKRMQHIZTGR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(CCCC2=O)=CC=C1

Synonyms:

• 1-Tetralone-8-carboxylic acid
• 1-Naphthalenecarboxylic acid, 5,6,7,8-tetrahydro-8-oxo-
• 8-Oxo-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid
• 5,6,7,8-Tetrahydro-8-oxo-1-naphthalenecarboxylic acid