CAS 7764-29-6
:2,2′-Thiobis[1H-isoindole-1,3(2H)-dione]
Description:
2,2′-Thiobis[1H-isoindole-1,3(2H)-dione], also known by its CAS number 7764-29-6, is a chemical compound characterized by its unique structure, which features two isoindole-1,3-dione moieties linked by a sulfur atom. This compound typically appears as a solid and is known for its potential applications in various fields, including organic synthesis and materials science. It exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. The presence of the thiol group contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and redox processes. Additionally, its structural features may impart interesting optical or electronic properties, making it a subject of interest in research related to organic electronics or photonic materials. Safety data indicates that, like many chemical substances, it should be handled with care, using appropriate safety measures to avoid exposure.
Formula:C16H8N2O4S
InChI:InChI=1S/C16H8N2O4S/c19-13-9-5-1-2-6-10(9)14(20)17(13)23-18-15(21)11-7-3-4-8-12(11)16(18)22/h1-8H
InChI key:InChIKey=QYIWBOWEQBEAGP-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1SN3C(=O)C=4C(C3=O)=CC=CC4)=CC=CC2
Synonyms:- 1H-Isoindole-1,3(2H)-dione, 2,2′-thiobis-
- 2,2'-sulfanediylbis(1H-isoindole-1,3(2H)-dione)
- 2,2′-Thiobis(isoindoline-1,3-dione)
- 2,2′-Thiobis[1H-isoindole-1,3(2H)-dione]
- N,N'-Thiobisphthalimide
- N,N′-Thiodiphthalimide
- NSC 75099
- Phthalimide, N,N′-thiodi-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N,N'-Thiodiphthalimide
CAS:Formula:C16H8N2O4SPurity:>97.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:324.312,2'-Thiobis[1H-isoindole-1,3(2H)-dione]
CAS:Formula:C16H8N2O4SPurity:95%Color and Shape:SolidMolecular weight:324.31072,2'-Thiobis(isoindoline-1,3-dione)
CAS:2,2'-Thiobis(isoindoline-1,3-dione)Purity:95%Molecular weight:324.32g/molN,N'-Thiodiphthalimide (>90%)
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications N,N'-Thiodiphthalimide has been used in the design, synthesis and biological evaluation of novel podophyllotoxin derivatives bearing 4β-disulfide/trisulfide bond as cytotoxic agents.<br>References Zhu S. J., et al., RSC Advances, 5, 103172-103183, 2015<br></p>Formula:C16H8N2O4SPurity:>90%Color and Shape:NeatMolecular weight:324.31N,N'-Thiodiphthalimide
CAS:<p>N,N'-Thiodiphthalimide (TDPA) is a molecule that has the chemical formula C6H11NOS. TDPA is an amine with a catalytic effect and sulfur transfer activity. TDPA can be used in the synthesis of thianthrene. The reaction of TDPA with sulfur trioxide yields sulfhydryl groups on the ring, which are important for TDPA's catalytic properties. The addition of x-rays to TDPA causes absorption spectroscopy, which can be used to identify functional groups and interactions with other molecules. TDPA also has a solvent effect on reactions involving hydroxyl compounds such as phenols, alcohols, and ethers. This chemical is thermodynamically stable at room temperature and pressure.</p>Formula:C16H8N2O4SPurity:Min. 95%Molecular weight:324.31 g/mol





