CAS 7764-30-9
:2,2′-Dithiobis[1H-isoindole-1,3(2H)-dione]
Description:
2,2′-Dithiobis[1H-isoindole-1,3(2H)-dione], commonly referred to by its CAS number 7764-30-9, is a chemical compound characterized by its unique structure that features two isoindole-1,3-dione units linked by a dithiobis group. This compound is notable for its potential applications in organic synthesis and materials science due to its ability to participate in various chemical reactions, including redox processes. It exhibits properties typical of dithiols and can act as a reducing agent or a ligand in coordination chemistry. The presence of the isoindole moiety contributes to its stability and reactivity, making it a subject of interest in the development of novel materials and pharmaceuticals. Additionally, its solubility and interaction with other chemical species can vary based on the solvent and conditions, which is crucial for its application in different chemical environments. Overall, 2,2′-Dithiobis[1H-isoindole-1,3(2H)-dione] is a versatile compound with significant implications in both research and industrial applications.
Formula:C16H8N2O4S2
InChI:InChI=1S/C16H8N2O4S2/c19-13-9-5-1-2-6-10(9)14(20)17(13)23-24-18-15(21)11-7-3-4-8-12(11)16(18)22/h1-8H
InChI key:InChIKey=XVJMNRIABVPIOU-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1SSN3C(=O)C=4C(C3=O)=CC=CC4)=CC=CC2
Synonyms:- 1H-Isoindole-1,3(2H)-dione, 2,2′-dithiobis-
- 2,2'-disulfanediylbis(1H-isoindole-1,3(2H)-dione)
- 2,2′-Dithiobis[1H-isoindole-1,3(2H)-dione]
- N,N′-Dithiobis(phthalimide)
- Phthalimide, N,N′-dithiodi-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dithiobisphthalimide
CAS:Controlled ProductFormula:C16H8N2O4S2Color and Shape:NeatMolecular weight:356.38
