CAS 77640-21-2
:4-nitrophenyl 2-O-(6-deoxyhexopyranosyl)hexopyranoside
Description:
4-Nitrophenyl 2-O-(6-deoxyhexopyranosyl)hexopyranoside is a glycoside compound characterized by the presence of a nitrophenyl group and a sugar moiety. The structure features a 4-nitrophenyl group, which is known for its electron-withdrawing properties due to the nitro group, enhancing the compound's reactivity in various chemical reactions. The sugar component is a hexopyranoside, indicating that it is derived from a six-membered pyranose ring, and the presence of a 6-deoxy sugar suggests that one hydroxyl group has been replaced by a hydrogen atom, which can influence the compound's solubility and biological activity. This compound may exhibit specific interactions in biochemical pathways, making it of interest in fields such as medicinal chemistry and biochemistry. Its CAS number, 77640-21-2, allows for easy identification in chemical databases. Overall, the unique combination of functional groups in this compound contributes to its potential applications in research and industry.
Formula:C18H25NO12
InChI:InChI=1/C18H25NO12/c1-7-11(21)13(23)15(25)17(28-7)31-16-14(24)12(22)10(6-20)30-18(16)29-9-4-2-8(3-5-9)19(26)27/h2-5,7,10-18,20-25H,6H2,1H3
SMILES:CC1C(C(C(C(O1)OC1C(C(C(CO)OC1Oc1ccc(cc1)N(=O)=O)O)O)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
p-Nitrophenyl 2-O-(beta-L-Fucopyranosyl)-beta-D-galactopyranoside
CAS:Controlled ProductApplications A synthetic chromogenic substrate for the assay of α-fucosidases.
References DiCioccio, R.A., et al.: Anal. Biochem., 11, 176 (1981)Formula:C18H25NO12Color and Shape:NeatMolecular weight:447.394-Nitrophenyl 2-O-(b-L-fucopyranosyl)-b-D-galactopyranoside
CAS:4-Nitrophenyl 2-O-(b-L-fucopyranosyl)-b-D-galactopyranoside is a high-quality chromogenic substrate with excellent sensitivity specifically designed for enzymes' activity detection. This pNP substrate enables rapid, accurate, and measurable colorimetric visualization of enzymatic hydrolysis reactions. Researchers can easily and effectively monitor the release of 4-nitrophenol as a yellow product under laboratory conditions, allowing for convenient comparative analysis and identification of enzyme levels in various samples.Purity:Min. 95%Color and Shape:White SolidMolecular weight:447.39 g/mol


