CAS 77654-61-6
:(2-methylpiperidin-1-yl)(oxo)acetic acid
Description:
(2-Methylpiperidin-1-yl)(oxo)acetic acid, with the CAS number 77654-61-6, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a methyl group attached to the second carbon of the piperidine ring, enhancing its lipophilicity. The presence of the oxo group (a carbonyl group) and the acetic acid moiety contributes to its acidic properties, making it a potential candidate for various chemical reactions, including esterification and amidation. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid functional group, while the piperidine ring may provide some degree of basicity. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where piperidine derivatives are often explored for their biological activity. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C8H13NO3
InChI:InChI=1/C8H13NO3/c1-6-4-2-3-5-9(6)7(10)8(11)12/h6H,2-5H2,1H3,(H,11,12)
SMILES:CC1CCCCN1C(=O)C(=O)O
Synonyms:- 1-Piperidineacetic Acid, 2-Methyl-Α-Oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
