CAS 77658-39-0

(4α)-9-Hydroxy-15-oxokaur-16-en-18-oic acid

Description:

(4α)-9-Hydroxy-15-oxokaur-16-en-18-oic acid, with the CAS number 77658-39-0, is a naturally occurring compound classified as a diterpenoid. This substance is characterized by its complex molecular structure, which includes a hydroxyl group and a ketone functional group, contributing to its reactivity and potential biological activity. The presence of the 9-hydroxy and 15-oxokaurane moieties suggests that it may play a role in various biochemical pathways, possibly exhibiting anti-inflammatory or antimicrobial properties. Diterpenoids like this compound are often derived from plant sources and can be involved in plant defense mechanisms. The stereochemistry indicated by the (4α) designation suggests specific spatial arrangements of atoms, which can significantly influence the compound's biological interactions and pharmacological effects. Overall, (4α)-9-Hydroxy-15-oxokaur-16-en-18-oic acid represents a fascinating area of study within natural products chemistry, with potential implications in medicinal chemistry and pharmacognosy.

Formula: C₂₀H₂₈O₄

InChI: InChI=1S/C20H28O4/c1-12-13-5-10-20(24)18(3)8-4-7-17(2,16(22)23)14(18)6-9-19(20,11-13)15(12)21/h13-14,24H,1,4-11H2,2-3H3,(H,22,23)/t13-,14-,17-,18-,19+,20-/m1/s1

InChI key: InChIKey=AURKCYFYZBQUIZ-FIXWDHIASA-N

SMILES: O[C@]12[C@]3(C[C@](C(=C)C3=O)(CC1)[H])CC[C@]4([C@@]2(C)CCC[C@]4(C(O)=O)C)[H]

Synonyms:

• Kaur-16-en-18-oic acid, 9-hydroxy-15-oxo-, (4α)-
• (4α)-9-Hydroxy-15-oxokaur-16-en-18-oic acid
• Pterokaurane L1

ent-9-Hydroxy-15-oxo-16-kauren-19-oic acid

CAS: 77658-39-0

ent-9-Hydroxy-15-oxo-16-kauren-19-oic acid is a natural product for research related to life sciences.

Formula: C₂₀H₂₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 332.44

Ref: TM-TN3956

ent-9-Hydroxy-15-oxokaur-16-en-19-oic acid

CAS: 77658-39-0

Formula: C₂₀H₂₈O₄

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 332.44

Ref: BP-SBP01341

Ent-9-hydroxy-15-oxokaur-16-en-19-oic acid

CAS: 77658-39-0

Ent-9-hydroxy-15-oxokaur-16-en-19-oic acid is a diterpenoid compound, which is a type of terpenoid characterized by having twenty carbon atoms. It is derived from kaurenoid sources, typically isolated from plants in the Asteraceae family. This class of compounds is notable for their complex polycyclic structures.

Formula: C₂₀H₂₈O₄

Purity: Min. 95%

Molecular weight: 332.4 g/mol

Ref: 3D-CDA65839