CAS 77658-84-5
:3-Phenylacetylamino-2,6-piperidinedione
Description:
3-Phenylacetylamino-2,6-piperidinedione, with the CAS number 77658-84-5, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring substituted with both an acetylamino group and a phenyl group, contributing to its unique properties. This compound is characterized by its potential biological activity, often studied for its pharmacological effects. The presence of the phenyl group may enhance lipophilicity, influencing its interaction with biological membranes and receptors. The piperidinedione structure suggests that it may participate in various chemical reactions, including those typical of amides and diketones. Additionally, the compound may exhibit solubility in organic solvents, while its stability can be influenced by environmental factors such as pH and temperature. Research into this compound may focus on its synthesis, characterization, and potential applications in medicinal chemistry, particularly in the development of therapeutic agents. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C13H14N2O3
InChI:InChI=1/C13H14N2O3/c16-11-7-6-10(13(18)15-11)14-12(17)8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,17)(H,15,16,18)
SMILES:c1ccc(cc1)CC(=NC1CCC(=NC1=O)O)O
Synonyms:- 3-((Phenylacetyl)amino)-2,6-piperidinedione
- 3-(N-Phenylacetylamino)-2,6-piperidinedione
- benzeneacetamide, N-(2,6-dioxo-3-piperidinyl)-
- N-(2,6-Dioxo-3-piperidinyl)benzeneacetamide
- N-(2,6-Dioxopiperidin-3-yl)-2-phenylacetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzeneacetamide,N-(2,6-dioxo-3-piperidinyl)-
CAS:Formula:C13H14N2O3Purity:99%Color and Shape:SolidMolecular weight:246.2619Ref: IN-DA008OSD
1gTo inquire1mg56.00€5mg55.00€10mg60.00€25mg130.00€50mg173.00€100mg199.00€250mg317.00€(Rac)-Antineoplaston A10
CAS:Antineoplaston A10 is the first identified human antineoplaston, naturally occurring with anti-proliferative properties.Formula:C13H14N2O3Purity:98.41%Color and Shape:SolidMolecular weight:246.26Ref: TM-T5379
1mg40.00€5mg88.00€10mg129.00€25mg210.00€50mg311.00€100mg449.00€200mg627.00€1mL*10mM (DMSO)95.00€3-Phenylacetylamino-2,6-piperidinedione
CAS:3-Phenylacetylamino-2,6-piperidinedione is a trifluoroacetate analog of the amino acid phenylalanine. It has been shown to be effective against cancer cells. 3-Phenylacetylamino-2,6-piperidinedione inhibits protein synthesis in tumor cells and is used as an antiestrogen in clinical studies. The hydroxyl group on the 3rd carbon atom makes this compound more acidic than its parent compound, 2,6-piperidinedione. This analog also has a high affinity for cancer tissues and urine samples. Treatment with this drug inhibits the growth of carcinoma cell lines MCT7 and MCF7.
Formula:C13H14N2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:246.26 g/molN-(2,6-Dioxopiperidin-3-yl)-2-phenylacetamide
CAS:Formula:C13H14N2O3Purity:99%Molecular weight:246.266




