CymitQuimica logo

CAS 7767-00-2

:

(2S)-2-(benzyloxycarbonylamino)-5-(1,3-dioxoisoindolin-2-yl)pentanoic acid

Description:
The chemical substance known as (2S)-2-(benzyloxycarbonylamino)-5-(1,3-dioxoisoindolin-2-yl)pentanoic acid, with the CAS number 7767-00-2, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a pentanoic acid backbone, which is an aliphatic carboxylic acid, and incorporates a benzyloxycarbonyl (Z) protecting group on the amino group, enhancing its stability and solubility. The presence of the 1,3-dioxoisoindolin-2-yl moiety indicates that the compound has a bicyclic structure, which contributes to its potential biological activity. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Its solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for further research in drug design and synthesis. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical applications.
Formula:C21H20N2O6
InChI:InChI=1/C21H20N2O6/c24-18-15-9-4-5-10-16(15)19(25)23(18)12-6-11-17(20(26)27)22-21(28)29-13-14-7-2-1-3-8-14/h1-5,7-10,17H,6,11-13H2,(H,22,28)(H,26,27)/t17-/m0/s1
SMILES:c1ccc(cc1)COC(=N[C@@H](CCCN1C(=O)c2ccccc2C1=O)C(=O)O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.