CAS 7768-48-1
:(17β)-17-[(2,2-Dichloroacetyl)oxy]androst-4-en-3-one
Description:
The chemical substance known as (17β)-17-[(2,2-Dichloroacetyl)oxy]androst-4-en-3-one, with the CAS number 7768-48-1, is a synthetic steroid derivative. It features a steroid backbone, characterized by a four-ring structure typical of steroids, with specific functional groups that modify its biological activity. The presence of the 2,2-dichloroacetyl group indicates that it has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound is known for its hormonal activity, often related to androgenic or anabolic effects, which can influence various physiological processes. Its structural modifications can enhance its potency, selectivity, or metabolic stability compared to natural steroids. Additionally, the compound's solubility, stability, and reactivity can be influenced by its functional groups, making it of interest in both research and therapeutic contexts. Safety and handling precautions are essential due to its chemical properties and potential biological effects.
Formula:C21H28Cl2O3
InChI:InChI=1S/C21H28Cl2O3/c1-20-9-7-13(24)11-12(20)3-4-14-15-5-6-17(26-19(25)18(22)23)21(15,2)10-8-16(14)20/h11,14-18H,3-10H2,1-2H3/t14-,15-,16-,17-,20-,21-/m0/s1
InChI key:InChIKey=JPTSHJNSSYTFFZ-KZVLABISSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@H](OC(C(Cl)Cl)=O)CC4)[H])(CCC1=CC(=O)CC2)[H])[H]
Synonyms:- Testosterone, dichloroacetate
- (17β)-17-[(2,2-Dichloroacetyl)oxy]androst-4-en-3-one
- Androst-4-en-3-one, 17-[(2,2-dichloroacetyl)oxy]-, (17β)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(17β)-17-[(2,2-Dichloroacetyl)oxy]androst-4-en-3-one
CAS:Controlled ProductFormula:C21H28Cl2O3Color and Shape:NeatMolecular weight:399.351
