CAS 77691-34-0

5-Chloro-2-hydroxy-3-nitrobenzenemethanol

Description:

5-Chloro-2-hydroxy-3-nitrobenzenemethanol, with the CAS number 77691-34-0, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom, a hydroxyl group, and a nitro group. This compound typically exhibits a pale yellow to brownish color and is soluble in polar solvents due to the presence of the hydroxyl group, which enhances its hydrophilicity. The nitro group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. The presence of multiple functional groups suggests that it may exhibit interesting biological activities, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and disposal, as compounds with chlorine and nitro groups can pose health and environmental risks.

Formula: C₇H₆ClNO₄

InChI: InChI=1S/C7H6ClNO4/c8-5-1-4(3-10)7(11)6(2-5)9(12)13/h1-2,10-11H,3H2

InChI key: InChIKey=GPKWEXOAODIYBU-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(O)C(CO)=CC(Cl)=C1

Synonyms:

• Benzenemethanol, 5-chloro-2-hydroxy-3-nitro-
• 5-Chloro-2-hydroxy-3-nitrobenzenemethanol