CymitQuimica logo

CAS 77694-20-3

:

N-(5,5-dimethyl-2-oxotetrahydrofuran-3-yl)-2,2,2-trifluoroacetamide

Description:
N-(5,5-dimethyl-2-oxotetrahydrofuran-3-yl)-2,2,2-trifluoroacetamide, with the CAS number 77694-20-3, is a chemical compound characterized by its unique structural features, including a tetrahydrofuran ring and a trifluoroacetamide functional group. This compound typically exhibits properties associated with both amides and cyclic ketones, such as moderate polarity and potential hydrogen bonding capabilities due to the presence of the amide group. The trifluoroacetamide moiety contributes to its stability and reactivity, particularly in organic synthesis and medicinal chemistry applications. The presence of the trifluoromethyl group enhances lipophilicity and can influence biological activity, making it of interest in pharmaceutical research. Additionally, the compound may exhibit specific solubility characteristics in various organic solvents, which can be important for its application in chemical reactions or formulations. Overall, this compound's unique structure and functional groups suggest potential utility in various chemical and biological contexts, although specific reactivity and stability would depend on the surrounding conditions and environment.
Formula:C8H10F3NO3
InChI:InChI=1/C8H10F3NO3/c1-7(2)3-4(5(13)15-7)12-6(14)8(9,10)11/h4H,3H2,1-2H3,(H,12,14)
SMILES:CC1(C)CC(C(=O)O1)N=C(C(F)(F)F)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.