CAS 777-33-3

(S)-(-)-2-(trifluoroacetamido)succinic anhydride,

Description:

(S)-(-)-2-(trifluoroacetamido)succinic anhydride, with CAS number 777-33-3, is a chemical compound characterized by its anhydride functional group and the presence of a trifluoroacetamido substituent. This compound is typically a white to off-white solid at room temperature and is known for its reactivity, particularly in acylation reactions. The trifluoroacetamido group enhances its electrophilicity, making it useful in organic synthesis, especially in the modification of amino acids and peptides. The anhydride structure allows it to react with nucleophiles, facilitating the formation of amides or esters. Additionally, the presence of fluorine atoms contributes to its unique properties, such as increased lipophilicity and potential biological activity. Due to its specific stereochemistry, it may exhibit distinct interactions in biological systems, making it of interest in pharmaceutical research. Proper handling and storage are essential, as it may be sensitive to moisture and can react with water to form the corresponding acid.

Formula: C₆H₄F₃NO₄

InChI: InChI=1/C6H4F3NO4/c7-6(8,9)5(13)10-2-1-3(11)14-4(2)12/h2H,1H2,(H,10,13)/t2-/m0/s1

SMILES: C1[C@@H](C(=O)OC1=O)N=C(C(F)(F)F)O

Synonyms:

• N-[(3S)-2,5-dioxotetrahydrofuran-3-yl]-2,2,2-trifluoroacetamide

(S)-(-)-2-(TRIFLUOROACETAMIDO)SUCCINIC ANHYDRIDE

CAS: 777-33-3

Formula: C₆H₄F₃NO₄

Molecular weight: 211.0955

Ref: IN-DA003CER

N-[(3S)-2,5-Dioxotetrahydro-3-furanyl]-2,2,2-trifluoroacetamide

CAS: 777-33-3

N-[(3S)-2,5-Dioxotetrahydro-3-furanyl]-2,2,2-trifluoroacetamide is a boronic acid that has been used to synthesize polymers. This compound is of interest for the synthesis of hydrophobic amino acids such as threonine and lysine. The high yield and functionalisation of this molecule make it deserving of further investigation.

Formula: C₆H₄F₃NO₄

Purity: Min. 95%

Molecular weight: 211.1 g/mol

Ref: 3D-FD97166