
CAS 777-38-8
:2-Methyl-1-(phenylmethyl)piperidine
Description:
2-Methyl-1-(phenylmethyl)piperidine, with the CAS number 777-38-8, is an organic compound belonging to the piperidine class of chemicals. It features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted with a methyl group at the second position and a phenylmethyl group at the first position. This compound is typically characterized by its molecular structure, which contributes to its potential biological activity. It is a colorless to pale yellow liquid with a distinctive odor, and it is soluble in organic solvents. The presence of both the methyl and phenylmethyl groups can influence its reactivity and interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. Additionally, its properties may include moderate volatility and a relatively low boiling point compared to larger organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H19N
InChI:InChI=1S/C13H19N/c1-12-7-5-6-10-14(12)11-13-8-3-2-4-9-13/h2-4,8-9,12H,5-7,10-11H2,1H3
InChI key:InChIKey=IGOHZRWAEINEMC-UHFFFAOYSA-N
SMILES:C(N1C(C)CCCC1)C2=CC=CC=C2
Synonyms:- 2-Pipecoline, 1-benzyl-
- Piperidine, 2-methyl-1-(phenylmethyl)-
- 2-Methyl-1-(phenylmethyl)piperidine
- 1-Benzyl-2-methylpiperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.