CAS 7770-78-7: (-)-Arctigenin
Description:(-)-Arctigenin is a naturally occurring lignan compound, primarily found in various plants, including the burdock root (Arctium lappa). It is characterized by its phenolic structure, which contributes to its biological activities. The compound exhibits a range of pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects. (-)-Arctigenin has been studied for its ability to modulate various signaling pathways, which may influence cell proliferation and apoptosis. Additionally, it has shown promise in protecting against neurodegenerative diseases due to its neuroprotective properties. The substance is typically soluble in organic solvents and has limited solubility in water, which can affect its bioavailability. Its molecular formula reflects a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its diverse biological activities. Overall, (-)-Arctigenin is of significant interest in medicinal chemistry and pharmacology for its potential therapeutic applications.
Formula:C21H24O6
InChI:InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1
InChI key:InChIKey=NQWVSMVXKMHKTF-JKSUJKDBSA-N
SMILES:O=C1OCC(CC2=CC=C(OC)C(OC)=C2)C1CC3=CC=C(O)C(OC)=C3
- Synonyms:
- (3R,4R)-4-(3,4-dimethoxybenzyl)-3-(4-hydroxy-3-methoxybenzyl)dihydrofuran-2(3H)-one
- (3R,4R)-4-[(3,4-Dimethoxyphenyl)methyl]dihydro-3-[(4-hydroxy-3-methoxyphenyl)methyl]-2(3H)-furanone
- 2(3H)-Furanone, 4-((3,4-dimethoxyphenyl)methyl)dihydro-3-((4-hydroxy-3-methoxyphenyl)methyl)-, (3R,4R)-
- 2(3H)-Furanone, 4-((3,4-dimethoxyphenyl)methyl)dihydro-3-((4-hydroxy-3-methoxyphenyl)methyl)-, (3R-trans)-
- 4-(3,4-dimethoxybenzyl)-3-(4-hydroxy-3-methoxybenzyl)dihydrofuran-2(3H)-one
- Arctidine
- (-)-Arctigenin
- (-)-Arctigenin
- Arctigenin
