
CAS 777011-50-4
:(2S)-2-Amino-4-(dimethylamino)butanoic acid
Description:
(2S)-2-Amino-4-(dimethylamino)butanoic acid, commonly known as DMAB, is an amino acid derivative characterized by its unique structure that includes a dimethylamino group attached to the butanoic acid backbone. This compound features a chiral center at the second carbon, which contributes to its stereochemistry, specifically the S configuration. DMAB is soluble in water due to its polar functional groups, making it suitable for various biochemical applications. It is often studied for its potential role in enhancing cognitive function and as a precursor in the synthesis of other bioactive compounds. The presence of the dimethylamino group may influence its interaction with biological systems, potentially affecting its pharmacological properties. As with many amino acids, DMAB can participate in peptide bond formation, making it relevant in protein synthesis and biochemistry. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use in laboratory or industrial settings.
Formula:C6H14N2O2
InChI:InChI=1S/C6H14N2O2/c1-8(2)4-3-5(7)6(9)10/h5H,3-4,7H2,1-2H3,(H,9,10)/t5-/m0/s1
InChI key:InChIKey=XVQRABGSXSUQLJ-YFKPBYRVSA-N
SMILES:[C@H](CCN(C)C)(C(O)=O)N
Synonyms:- Butanoic acid, 2-amino-4-(dimethylamino)-, (S)-
- (2S)-2-Amino-4-(dimethylamino)butanoic acid
- (S)-2-Amino-4-(dimethylamino)butanoic acid
- Butanoic acid, 2-amino-4-(dimethylamino)-, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.