CAS 777029-08-0

Ethyl 3-thiopheneethanimidate

Description:

Ethyl 3-thiopheneethanimidate is a chemical compound characterized by its unique structure, which includes an ethyl group and a thiophene ring, contributing to its aromatic properties. This compound typically exhibits a moderate level of solubility in organic solvents, reflecting the influence of the thiophene moiety on its polarity. Ethyl 3-thiopheneethanimidate may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions, due to the presence of the imidate functional group. Its potential applications could span across fields such as organic synthesis, pharmaceuticals, or materials science, where thiophene derivatives are often valued for their electronic properties. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and the presence of other reagents. As with many organic compounds, safety precautions should be observed when handling Ethyl 3-thiopheneethanimidate, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.

Formula: C₈H₁₁NOS

InChI: InChI=1S/C8H11NOS/c1-2-10-8(9)5-7-3-4-11-6-7/h3-4,6,9H,2,5H2,1H3

InChI key: InChIKey=YMSCWJLJYFMNRZ-UHFFFAOYSA-N

SMILES: C(C(OCC)=N)C=1C=CSC1

Synonyms:

• Ethyl 3-thiopheneethanimidate
• 3-Thiopheneethanimidic acid, ethyl ester