CAS 777074-52-9
:Phenylmethyl 3-fluoro-4-formylbenzoate
Description:
Phenylmethyl 3-fluoro-4-formylbenzoate, with the CAS number 777074-52-9, is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a phenylmethyl group, a 3-fluoro substituent, and a 4-formyl group on the benzene ring, contributing to its unique chemical properties. The presence of the fluoro group typically enhances the compound's reactivity and can influence its polarity and solubility in various solvents. The formyl group indicates that it contains an aldehyde functional group, which is known for its reactivity in condensation reactions and as a precursor in various synthetic pathways. The compound's structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of multiple functional groups may allow for further derivatization, making it a versatile intermediate in chemical reactions. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H11FO3
InChI:InChI=1S/C15H11FO3/c16-14-8-12(6-7-13(14)9-17)15(18)19-10-11-4-2-1-3-5-11/h1-9H,10H2
InChI key:InChIKey=YJAXZHBOMSCJLU-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)C2=CC(F)=C(C=O)C=C2
Synonyms:- Phenylmethyl 3-fluoro-4-formylbenzoate
- Benzoic acid, 3-fluoro-4-formyl-, phenylmethyl ester
- 3-Fluoro-4-formylbenzoic acid benzyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
