CAS 77709-02-5

4,6-Pyrimidinediamine, sulfate (2:1)

Description:

4,6-Pyrimidinediamine, sulfate (2:1), with the CAS number 77709-02-5, is a chemical compound characterized by its pyrimidine ring structure, which contains two amino groups at the 4 and 6 positions. This compound is typically encountered as a sulfate salt, indicating that it forms a stable ionic compound with sulfate ions. It is often used in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. The presence of amino groups contributes to its reactivity and ability to form hydrogen bonds, which can influence its solubility and interaction with biological systems. As a sulfate salt, it is likely to be soluble in water, making it suitable for various formulations. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4,6-Pyrimidinediamine, sulfate (2:1) is a compound of interest in both research and industrial applications due to its unique structural features and properties.

Formula: C₄H₆N₄H₂O₄S

InChI: InChI=1S/C4H6N4.H2O4S/c5-3-1-4(6)8-2-7-3;1-5(2,3)4/h1-2H,(H4,5,6,7,8);(H2,1,2,3,4)

InChI key: InChIKey=KVQQUKZVGBKTLQ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)O.NC=1C=C(N)N=CN1

Synonyms:

• 4,6-Diaminopyrimidine hemisulfate
• 4,6-Pyrimidinediamine, sulfate (2:1)
• Pyrimidine-4,6-Diamine Hydrate
• Pyrimidine-4,6-diammonium hydrogen sulphate (1:2)