CAS 77709-14-9

4-Methyl-3-pyridazinecarboxaldehyde

Description:

4-Methyl-3-pyridazinecarboxaldehyde is an organic compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methyl group at the 4-position and an aldehyde functional group at the 3-position, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the aldehyde group makes it a versatile intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, 4-Methyl-3-pyridazinecarboxaldehyde may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its chemical properties include the ability to undergo typical reactions associated with aldehydes, such as oxidation and condensation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₆H₆N₂O

InChI: InChI=1S/C6H6N2O/c1-5-2-3-7-8-6(5)4-9/h2-4H,1H3

InChI key: InChIKey=AFGNOPFNAWWURV-UHFFFAOYSA-N

SMILES: C(=O)C1=C(C)C=CN=N1

Synonyms:

• 4-Methyl-3-pyridazinecarboxaldehyde
• 3-Pyridazinecarboxaldehyde, 4-methyl-