CAS 7771-09-7
:2-(1,3-thiazol-4-yl)ethanamine dihydrochloride
Description:
2-(1,3-thiazol-4-yl)ethanamine dihydrochloride is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity. This compound features an ethanamine moiety, indicating the presence of an amine group attached to an ethyl chain. The dihydrochloride form suggests that the compound is a salt, with two hydrochloric acid molecules associated with the amine, enhancing its solubility in water. Typically, compounds like this are studied for their potential pharmacological properties, including antimicrobial or anti-inflammatory effects, due to the presence of the thiazole ring, which is known for its reactivity and ability to interact with biological targets. The compound is often utilized in research settings, particularly in medicinal chemistry, to explore its efficacy and mechanism of action. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C5H10Cl2N2S
InChI:InChI=1/C5H8N2S.2ClH/c6-2-1-5-3-8-4-7-5;;/h3-4H,1-2,6H2;2*1H
SMILES:C(CN)c1cscn1.Cl.Cl
Synonyms:- 4-Thiazoleethanamine, dihydrochloride
- 4-Thiazoleethanamine, hydrochloride (1:2)
- 2-(1,3-Thiazol-4-yl)ethanamine dihydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(1,3-Thiazol-4-yl)ethan-1-amine Dihydrochloride
CAS:Controlled ProductFormula:C5H8N2S·2HClColor and Shape:NeatMolecular weight:248.152

