CymitQuimica logo

CAS 7771-44-0

:

5,8,11,14-Eicosatetraenoic acid

Description:
5,8,11,14-Eicosatetraenoic acid, commonly known as arachidonic acid, is a polyunsaturated fatty acid with a long carbon chain consisting of 20 carbon atoms and four double bonds, specifically located at the 5th, 8th, 11th, and 14th positions. It is classified as an omega-6 fatty acid, which plays a crucial role in cellular signaling and is a precursor for the synthesis of various bioactive lipids, including prostaglandins, thromboxanes, and leukotrienes. Arachidonic acid is primarily found in animal tissues, particularly in the phospholipids of cell membranes, and is essential for various physiological processes, including inflammation and immune response. Its structure allows for significant flexibility and reactivity, making it vital in the formation of signaling molecules. Arachidonic acid is also important in nutrition, as it can be obtained from dietary sources, particularly from meat and eggs, and is synthesized in the body from linoleic acid. Its CAS number is 7771-44-0, which is used for identification in chemical databases.
Formula:C20H32O2
InChI:InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)
InChI key:InChIKey=YZXBAPSDXZZRGB-UHFFFAOYSA-N
SMILES:C(=CCC=CCC=CCCCCC)CC=CCCCC(O)=O
Synonyms:
  • 5,8,11,14-Eicosatetraenoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.