CAS 77710-57-7

2'-deoxycytidylyl(3'5')-2'-*deoxyguanosine ammoni

Description:

2'-Deoxycytidylyl(3'5')-2'-deoxyguanosine ammonium, identified by its CAS number 77710-57-7, is a nucleotide analog that plays a significant role in molecular biology and biochemistry. This compound consists of a deoxyribonucleotide structure, which includes a deoxyribose sugar, a phosphate group, and nitrogenous bases—cytosine and guanine. The 3'5' linkage indicates that the nucleotides are connected through phosphodiester bonds, which are crucial for the formation of nucleic acid chains. The presence of the ammonium group suggests that it may exist in a protonated form, influencing its solubility and interaction with other biomolecules. This compound is often utilized in research related to DNA synthesis, gene expression studies, and the development of therapeutic agents. Its structural characteristics allow it to participate in various biochemical processes, including enzymatic reactions and hybridization with complementary nucleic acid sequences. Overall, 2'-deoxycytidylyl(3'5')-2'-deoxyguanosine ammonium is an important molecule in the study of genetic material and its functions.

Formula: C₁₉H₂₈N₉O₁₀P

InChI: InChI=1/C19H25N8O10P.H3N/c20-12-1-2-26(19(31)23-12)14-4-9(10(5-28)35-14)37-38(32,33)34-6-11-8(29)3-13(36-11)27-7-22-15-16(27)24-18(21)25-17(15)30;/h1-2,7-11,13-14,28-29H,3-6H2,(H,32,33)(H2,20,23,31)(H3,21,24,25,30);1H3

SMILES: c1cn(C2CC(C(CO)O2)OP(=O)(O)OCC2C(CC(n3cnc4c3[nH]c(=N)nc4O)O2)O)c(nc1=N)O.N

2'-Deoxycytidyl-(3'-5')-2'-deoxyguanosine

CAS: 77710-57-7

2'-Deoxycytidyl-(3'-5')-2'-deoxyguanosine is a monophosphate nucleoside. It is an antiviral agent that inhibits the synthesis of DNA and RNA. 2'-Deoxycytidyl-(3'-5')-2'-deoxyguanosine has also been shown to be cytotoxic against cancer cells, with activities against leukemia and lymphoma cells. This drug can be used in the treatment of various cancers, such as chronic myelogenous leukemia, acute myelogenous leukemia, multiple myeloma, Hodgkin's lymphoma, and breast cancer.

Formula: C₁₉H₂₅N₈O₁₀P·NH₃

Purity: Min. 95%

Molecular weight: 573.45 g/mol

Ref: 3D-ND10434