CymitQuimica logo

CAS 77711-35-4

:

methyl 2-[(benzoylcarbamothioyl)amino]benzoate

Description:
Methyl 2-[(benzoylcarbamothioyl)amino]benzoate, with the CAS number 77711-35-4, is an organic compound characterized by its complex structure, which includes a methyl ester group, an amine, and a thioamide functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. It may display moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of functional groups, particularly the thioamide, which can participate in nucleophilic reactions. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where its unique functional groups may impart specific biological activities. Additionally, its synthesis and handling require standard laboratory safety protocols due to the presence of reactive functional groups. Overall, methyl 2-[(benzoylcarbamothioyl)amino]benzoate represents a versatile compound with potential utility in various chemical applications.
Formula:C16H14N2O3S
InChI:InChI=1/C16H14N2O3S/c1-21-15(20)12-9-5-6-10-13(12)17-16(22)18-14(19)11-7-3-2-4-8-11/h2-10H,1H3,(H2,17,18,19,22)
Synonyms:
  • benzoic acid, 2-[[(benzoylamino)thioxomethyl]amino]-, methyl ester
  • Methyl 2-[(benzoylcarbamothioyl)amino]benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.