CAS 77716-11-1
:4-tert-butoxycarbonylamino-1-methyl-1H-pyrrole-2 carboxylic
Description:
4-tert-Butoxycarbonylamino-1-methyl-1H-pyrrole-2-carboxylic acid, identified by the CAS number 77716-11-1, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a tert-butoxycarbonyl (Boc) protecting group, commonly used in organic synthesis to protect amines during chemical reactions. The presence of the carboxylic acid functional group contributes to its acidic properties, while the methyl group at the 1-position of the pyrrole ring influences its reactivity and sterics. The compound is typically utilized in peptide synthesis and other organic transformations due to its functional groups, which can participate in various chemical reactions, including amide bond formation. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, this compound serves as a valuable intermediate in the synthesis of more complex molecules in medicinal chemistry and related fields.
Formula:C11H16N2O4
InChI:InChI=1/C11H16N2O4/c1-11(2,3)17-10(16)12-7-5-8(9(14)15)13(4)6-7/h5-6H,1-4H3,(H,12,16)(H,14,15)
SMILES:CC(C)(C)OC(=Nc1cc(C(=O)O)n(C)c1)O
Synonyms:- 1H-Pyrrole-2-carboxylic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-1-methyl-
- 4-[(tert-Butoxycarbonyl)amino]-1-methyl-1H-pyrrole-2-carboxylic acid
- 4-(tert-butoxycarbonylamino)-1-methyl-1H-pyrrole-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-((tert-Butoxycarbonyl)amino)-1-methyl-1H-pyrrole-2-carboxylic acid
CAS:Formula:C11H16N2O4Purity:98%Color and Shape:SolidMolecular weight:240.25574-(Boc-amino)-1-methyl-1H-pyrrole-2-carboxylic Acid
CAS:Formula:C11H16N2O4Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:240.264-Amino-1-methyl-1H-pyrrole-2-carboxylic acid, 4-BOC protected
CAS:4-Amino-1-methyl-1H-pyrrole-2-carboxylic acid, 4-BOC protectedPurity:97%Color and Shape:Solid-CrystallineMolecular weight:240.26g/mol4-(Boc-amino)-1-methylpyrrole-2-carboxylic Acid
CAS:Controlled ProductApplications 4-(Boc-amino)-1-methylpyrrole-2-carboxylic Acid is an unnatural amino acid for preparing heteroaromatic oligoamides for regulating gen expression in biotechnology.
References Baird, E., et al.: J. Am. Chem. Soc., 118, 6141 (1996); White, S., et al.: Nature, 391, 468 (1998)Formula:C11H16N2O4Color and Shape:NeatMolecular weight:240.2564-tert-Butoxycarbonylamino-1-methyl-1H-pyrrole-2-carboxylic acid
CAS:Formula:C11H16N2O4Purity:97%Color and Shape:SolidMolecular weight:240.259





