CAS 7772-87-4
:[(3S,4R,5S,6S)-3,4-diacetoxy-6-chloro-5-(1,3-dioxoisoindolin-2-yl)tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(3S,4R,5S,6S)-3,4-diacetoxy-6-chloro-5-(1,3-dioxoisoindolin-2-yl)tetrahydropyran-2-yl]methyl acetate" and CAS number 7772-87-4 is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and includes multiple acetoxy groups that enhance its reactivity and solubility in organic solvents. The presence of a chlorine atom introduces halogen characteristics, potentially affecting its biological activity and reactivity. Additionally, the isoindolin-2-yl moiety contributes to its structural diversity and may influence its pharmacological properties. This compound is likely to exhibit specific interactions in biological systems due to its unique structure, making it of interest in medicinal chemistry and drug development. Its synthesis and applications may involve various organic reactions, including acylation and halogenation, highlighting its significance in synthetic organic chemistry.
Formula:C20H20ClNO9
InChI:InChI=1/C20H20ClNO9/c1-9(23)28-8-14-16(29-10(2)24)17(30-11(3)25)15(18(21)31-14)22-19(26)12-6-4-5-7-13(12)20(22)27/h4-7,14-18H,8H2,1-3H3/t14?,15-,16+,17+,18+/m0/s1
Synonyms:- 3,4,6-Tri-O-Acetyl-2-Deoxy-2-Fluoro-D-Mannopyranosyl Fluoride
- 2-Deoxy-2-phthaliMido-β-D-glucopyranosyl Chloride 3,4,6-Triacetate
- 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-b-D-glucopyranosylchloride
- β-D-Glucopyranosyl chloride, 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-, 3,4,6-triacetate
- 2-Deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-β-D-glucopyranosyl Chloride 3,4,6-Triacetate
- Chloro 2-Deoxy-2-N-phthalimido-3,4,6-tri-O-acetyl-β-D-glucopyranoside
- Chloro 2-Deoxy-2-N-phthalimido-3,4,6-tri-O-acetyl-2-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Chloro 2-Deoxy-2-N-phthalimido-3,4,6-tri-O-acetyl-beta-D-glucopyranoside
CAS:Controlled ProductStability Keep dry
Applications Chloro 2-Deoxy-2-N-phthalimido-3,4,6-tri-O-acetyl-β-D-glucopyranoside (cas# 7772-87-4) is a compound useful in organic synthesis.Formula:C20H20ClNO9Color and Shape:NeatMolecular weight:453.833,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-b-D-glucopyranosyl chloride
CAS:3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-b-D-glucopyranosyl chloride is a modification of the carbohydrate. It is a complex carbohydrate that has been custom synthesized for research purposes. It can be used as a monosaccharide or polysaccharide in glycosylation reactions. This compound has not been fluorinated and the CAS number is 7772-87-4.
Formula:C20H20ClNO9Purity:Min. 95%Molecular weight:453.83 g/molRef: 3D-MT05342
Discontinued product


