CAS 77723-03-6
:4-methylpiperazine-1-carboximidamide hydroiodide
Description:
4-Methylpiperazine-1-carboximidamide hydroiodide is a chemical compound characterized by its piperazine ring structure, which is a six-membered saturated heterocycle containing two nitrogen atoms. This compound features a carboximidamide functional group, which contributes to its potential as a building block in medicinal chemistry and drug development. The hydroiodide salt form indicates that it is combined with hydroiodic acid, enhancing its solubility in polar solvents and potentially influencing its biological activity. The presence of the methyl group at the 4-position of the piperazine ring can affect the compound's steric and electronic properties, which may play a role in its interaction with biological targets. This compound is of interest in various fields, including pharmacology and organic synthesis, due to its potential applications in developing therapeutic agents. As with many chemical substances, safety and handling precautions should be observed, particularly when dealing with salts and derivatives that may have specific reactivity or toxicity profiles.
Formula:C6H15IN4
InChI:InChI=1/C6H14N4.HI/c1-9-2-4-10(5-3-9)6(7)8;/h2-5H2,1H3,(H3,7,8);1H
SMILES:CN1CCN(CC1)C(=N)N.I
Synonyms:- 4-methyltetrahydro-1(2H)-pyrazinecarboximidamide hydroiodide
- 4-Methylpiperazine-1-carboximidamide hydroiodide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.