CymitQuimica logo

CAS 77723-05-8

:

4-(2-Furanylcarbonyl)-1-piperazinecarboximidamide

Description:
4-(2-Furanylcarbonyl)-1-piperazinecarboximidamide, with the CAS number 77723-05-8, is a chemical compound characterized by its unique structure that includes a piperazine ring and a furanylcarbonyl group. This compound typically exhibits properties associated with both amides and imidamides, which can influence its reactivity and potential applications in medicinal chemistry. The presence of the furanyl group may impart specific electronic and steric properties, making it of interest in the development of pharmaceuticals, particularly in targeting certain biological pathways. The piperazine moiety is known for its role in enhancing solubility and bioavailability in drug design. Additionally, the compound may exhibit various functional properties, such as potential antimicrobial or antitumor activity, depending on its interactions with biological systems. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the functional groups present. Overall, this compound represents a class of molecules that could be explored for therapeutic applications.
Formula:C10H14N4O2
InChI:InChI=1S/C10H14N4O2/c11-10(12)14-5-3-13(4-6-14)9(15)8-2-1-7-16-8/h1-2,7H,3-6H2,(H3,11,12)
InChI key:InChIKey=VYEKZMCQFRDRPH-UHFFFAOYSA-N
SMILES:C(=O)(N1CCN(C(=N)N)CC1)C2=CC=CO2
Synonyms:
  • 1-Piperazinecarboximidamide, 4-(2-furanylcarbonyl)-
  • 4-(2-Furanylcarbonyl)-1-piperazinecarboximidamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.