
CAS 77723-17-2
:4-(4-Methoxyphenyl)-1-piperazinecarboximidamide
Description:
4-(4-Methoxyphenyl)-1-piperazinecarboximidamide, identified by its CAS number 77723-17-2, is a chemical compound that features a piperazine ring, which is a six-membered saturated heterocycle containing two nitrogen atoms. This compound is characterized by the presence of a methoxyphenyl group, which contributes to its aromatic properties and potential interactions in biological systems. The carboximidamide functional group indicates that it has both amine and imine characteristics, which can influence its reactivity and solubility. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The presence of the methoxy group can enhance lipophilicity, potentially affecting the compound's ability to cross biological membranes. Overall, the structural features of 4-(4-Methoxyphenyl)-1-piperazinecarboximidamide suggest it may have applications in drug development or as a research tool in studying various biochemical pathways. However, specific biological activities and applications would require further investigation through empirical studies.
Formula:C12H18N4O
InChI:InChI=1S/C12H18N4O/c1-17-11-4-2-10(3-5-11)15-6-8-16(9-7-15)12(13)14/h2-5H,6-9H2,1H3,(H3,13,14)
InChI key:InChIKey=FIFLVAAKXGHCLX-UHFFFAOYSA-N
SMILES:C(=N)(N)N1CCN(CC1)C2=CC=C(OC)C=C2
Synonyms:- 4-(4-Methoxyphenyl)-1-piperazinecarboximidamide
- 1-Piperazinecarboximidamide, 4-(4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.