CAS 77729-22-7

2-(2-nitrophenoxy)acetohydrazide

Description:

2-(2-Nitrophenoxy)acetohydrazide is an organic compound characterized by its hydrazide functional group and a nitrophenoxy moiety. It typically appears as a solid and is soluble in polar organic solvents. The presence of the nitro group contributes to its potential reactivity and may influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, which can be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure suggests potential applications in agrochemicals or as an intermediate in organic synthesis. The compound's stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature. Safety data should be consulted for handling and storage, as compounds with nitro groups can sometimes pose hazards. Overall, 2-(2-nitrophenoxy)acetohydrazide is a versatile compound with potential applications in various fields of chemistry and biology.

Formula: C₈H₉N₃O₄

InChI: InChI=1/C8H9N3O4/c9-10-8(12)5-15-7-4-2-1-3-6(7)11(13)14/h1-4H,5,9H2,(H,10,12)

SMILES: c1ccc(c(c1)N(=O)=O)OCC(=NN)O

Synonyms:

• Acetic Acid, 2-(2-Nitrophenoxy)-, Hydrazide