CAS 77733-16-5
:(6R)-2-Methyl-6-[(1R,3aS,4E,7aR)-octahydro-4-[(2Z)-2-[(5S)-5-hydroxy-2-methylenecyclohexylidene]ethylidene]-7a-methyl-1H-inden-1-yl]-2,4-heptanediol
Description:
The chemical substance with the name "(6R)-2-Methyl-6-[(1R,3aS,4E,7aR)-octahydro-4-[(2Z)-2-[(5S)-5-hydroxy-2-methylenecyclohexylidene]ethylidene]-7a-methyl-1H-inden-1-yl]-2,4-heptanediol" and CAS number "77733-16-5" is a complex organic compound characterized by its intricate stereochemistry and multiple functional groups. It features a bicyclic structure, which contributes to its potential biological activity. The presence of hydroxyl groups indicates that it may exhibit polar characteristics, influencing its solubility and reactivity. The compound's stereocenters suggest that it may have specific interactions with biological systems, potentially making it relevant in medicinal chemistry or as a natural product. Its structural complexity may also imply that it could be synthesized through multi-step organic reactions, and its stability would depend on the specific conditions under which it is handled. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in various fields, including pharmaceuticals and materials science.
Formula:C27H44O3
InChI:InChI=1S/C27H44O3/c1-18-8-11-22(28)16-21(18)10-9-20-7-6-14-27(5)24(12-13-25(20)27)19(2)15-23(29)17-26(3,4)30/h9-10,19,22-25,28-30H,1,6-8,11-17H2,2-5H3/b20-9+,21-10-/t19-,22+,23?,24-,25+,27-/m1/s1
InChI key:InChIKey=JVBPQHSRTHJMLM-KROKRKHLSA-N
SMILES:C[C@@]12[C@](\C(=C\C=C\3/C(=C)CC[C@H](O)C3)\CCC1)(CC[C@@]2([C@@H](CC(CC(C)(C)O)O)C)[H])[H]
Synonyms:- (6R)-2-Methyl-6-[(1R,3aS,4E,7aR)-octahydro-4-[(2Z)-2-[(5S)-5-hydroxy-2-methylenecyclohexylidene]ethylidene]-7a-methyl-1H-inden-1-yl]-2,4-heptanediol
- 2,4-Heptanediol, 2-methyl-6-[(1R,3aS,4E,7aR)-octahydro-4-[(2Z)-2-[(5S)-5-hydroxy-2-methylenecyclohexylidene]ethylidene]-7a-methyl-1H-inden-1-yl]-, (6R)-
- 77733-16-5
- 9,10-Secocholesta-5,7,10(19)-triene-3,23,25-triol, (3β,5Z,7E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
23,25-Dihydroxy Vitamin D3
CAS:Controlled ProductFormula:C27H44O3Color and Shape:NeatMolecular weight:416.637

