CAS 77756-79-7
:[2-(3-Cyclohexenyl)ethyl]triethoxysilane
Description:
[2-(3-Cyclohexenyl)ethyl]triethoxysilane, with the CAS number 77756-79-7, is an organosilane compound characterized by its unique structure that includes a cyclohexene moiety and three ethoxy groups attached to a silicon atom. This compound typically exhibits properties such as good reactivity due to the presence of the ethoxy groups, which can hydrolyze to form silanol groups, facilitating bonding with various substrates, including glass, metals, and polymers. The cyclohexene ring contributes to its potential applications in organic synthesis and as a coupling agent in composite materials, enhancing adhesion and compatibility between organic and inorganic phases. Additionally, the presence of the unsaturated cyclohexene structure may allow for further functionalization through addition reactions. Overall, [2-(3-Cyclohexenyl)ethyl]triethoxysilane is valued in materials science and surface chemistry for its ability to modify surfaces and improve the properties of coatings and adhesives.
Formula:C14H28O3Si
InChI:InChI=1/C14H28O3Si/c1-4-15-18(16-5-2,17-6-3)13-12-14-10-8-7-9-11-14/h10H,4-9,11-13H2,1-3H3
SMILES:CCO[Si](CCC1=CCCCC1)(OCC)OCC
Synonyms:- Cyclohexenylethyltrimethoxysilane
- (2-Cyclohex-1-En-1-Ylethyl)(Triethoxy)Silane
- [2-(3-Cyclohexenyl)ethyl]triethoxysilane
- (2-(CYCLOHEXENYL)ETHYL)TRIETHOXYSILANE, MIXTURE OF ISOMERS
- Silane, [2-(cyclohexenyl)ethyl]triethoxy-
- [2-(Ethoxysilyl)ethyl]cyclohexene
- [2-(CYCLOHEXENYL)ETHYL]TRIETHOXYSILANE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.