CAS 77758-95-3
:2-[(pentafluoroethyl)sulfanyl]propanoic acid
Description:
2-[(Pentafluoroethyl)sulfanyl]propanoic acid, with the CAS number 77758-95-3, is a fluorinated organic compound characterized by the presence of a pentafluoroethyl group and a thiol functional group attached to a propanoic acid backbone. This compound features a sulfur atom bonded to a pentafluoroethyl group, which significantly influences its chemical properties, including its reactivity and polarity. The presence of multiple fluorine atoms contributes to its high electronegativity, making it a strong electron-withdrawing group. As a result, 2-[(pentafluoroethyl)sulfanyl]propanoic acid may exhibit unique behavior in chemical reactions, such as increased acidity compared to non-fluorinated analogs. Additionally, the compound may have applications in various fields, including pharmaceuticals and materials science, due to its distinctive properties. Its stability, solubility, and reactivity can be influenced by environmental factors, such as temperature and solvent choice. Overall, this compound represents a fascinating example of how fluorination can modify the characteristics of organic molecules.
Formula:C5H5F5O2S
InChI:InChI=1/C5H5F5O2S/c1-2(3(11)12)13-5(9,10)4(6,7)8/h2H,1H3,(H,11,12)
SMILES:CC(C(=O)O)SC(C(F)(F)F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.