CAS 77759-09-2

3-Methoxy-2-nitrobenzeneethanol

Description:

3-Methoxy-2-nitrobenzeneethanol, with the CAS number 77759-09-2, is an organic compound characterized by the presence of a methoxy group and a nitro group attached to a benzene ring, along with an ethanol moiety. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents due to its aromatic structure. The methoxy group contributes to its electron-donating properties, while the nitro group is an electron-withdrawing substituent, influencing the compound's reactivity and polarity. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it of interest in synthetic organic chemistry. Additionally, the presence of the hydroxyl group in the ethanol part of the molecule can impart hydrogen-bonding capabilities, affecting its physical properties such as boiling point and solubility. Safety data should be consulted, as nitro compounds can be hazardous, and appropriate handling procedures should be followed in laboratory settings.

Formula: C₉H₁₁NO₄

InChI: InChI=1S/C9H11NO4/c1-14-8-4-2-3-7(5-6-11)9(8)10(12)13/h2-4,11H,5-6H2,1H3

InChI key: InChIKey=PECHLROPLSUPDA-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(CCO)C=CC=C1OC

Synonyms:

• 2-(3-Methoxy-2-nitrophenyl)ethan-1-ol
• 3-Methoxy-2-nitrobenzeneethanol
• Benzeneethanol, 3-methoxy-2-nitro-