CymitQuimica logo

CAS 7776-77-4

:

7-Chloro-2′,4,6-trimethoxy-6′-methylspiro[benzofuran-2(3H),1′-[2,5]cyclohexadiene]-3,4′-dione

Description:
7-Chloro-2′,4,6-trimethoxy-6′-methylspiro[benzofuran-2(3H),1′-[2,5]cyclohexadiene]-3,4′-dione, with the CAS number 7776-77-4, is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of benzofuran and cyclohexadiene. This compound features multiple methoxy groups, contributing to its potential solubility and reactivity. The presence of chlorine and methyl substituents further influences its chemical properties, including its electronic characteristics and potential biological activity. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The spiro structure often leads to unique conformational properties, which can affect the compound's interactions with biological targets. Additionally, the presence of multiple functional groups suggests potential for various chemical reactions, including substitution and coupling reactions. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with potential applications in drug development and synthetic chemistry.
Formula:C17H15ClO6
InChI:InChI=1S/C17H15ClO6/c1-8-5-9(19)6-12(23-4)17(8)16(20)13-10(21-2)7-11(22-3)14(18)15(13)24-17/h5-7H,1-4H3
InChI key:InChIKey=ISLYVROQSJYFAZ-UHFFFAOYSA-N
SMILES:O=C1C2(OC=3C1=C(OC)C=C(OC)C3Cl)C(OC)=CC(=O)C=C2C
Synonyms:
  • (±)-Dehydrogriseofulvin
  • 7-Chloro-2′,4,6-trimethoxy-6′-methylspiro[benzofuran-2(3H),1′-[2,5]cyclohexadiene]-3,4′-dione
  • Spiro[benzofuran-2(3H),1′-[2,5]cyclohexadiene]-3,4′-dione, 7-chloro-2′,4,6-trimethoxy-6′-methyl-
  • Spiro[benzofuran-2(3H),1′-[2,5]cyclohexadiene]-3,4′-dione, 7-chloro-2′,4,6-trimethoxy-6′-methyl-, (±)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.