CAS 77767-14-7

3,7-bis[3-(trifluoromethyl)phenyl]-1,5,3,7-dioxadiazocane

Description:

3,7-bis[3-(trifluoromethyl)phenyl]-1,5,3,7-dioxadiazocane is a synthetic organic compound characterized by its unique molecular structure, which includes a dioxadiazocane backbone and two trifluoromethyl-substituted phenyl groups. The presence of trifluoromethyl groups enhances its lipophilicity and may impart unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The dioxadiazocane structure contributes to its stability and potential reactivity, particularly in the context of forming coordination complexes or participating in organic reactions. This compound is typically solid at room temperature and may exhibit specific solubility characteristics depending on the solvent used. Its fluorinated nature can also influence its interactions with biological systems, potentially affecting its bioactivity and environmental persistence. As with many synthetic compounds, safety data should be consulted to understand its toxicity and handling requirements. Overall, this compound represents a class of fluorinated organic molecules with diverse applications in chemistry and materials science.

Formula: C₁₈H₁₆F₆N₂O₂

InChI: InChI=1/C18H16F6N2O2/c19-17(20,21)13-3-1-5-15(7-13)25-9-27-11-26(12-28-10-25)16-6-2-4-14(8-16)18(22,23)24/h1-8H,9-12H2

SMILES: c1cc(cc(c1)N1COCN(COC1)c1cccc(c1)C(F)(F)F)C(F)(F)F

Synonyms:

• 2H,6H-1,5,3,7-Dioxadiazocine, tetrahydro-3,7-bis(3-(trifluoromethyl)phenyl)-
• Tetrahydro-3,7-bis(3-(trifluoromethyl)phenyl)-2H,6H-1,5,3,7-dioxadiazocine