CAS 77767-16-9

3,7-bis[4-(trifluoromethyl)phenyl]-1,5,3,7-dioxadiazocane

Description:

3,7-bis[4-(trifluoromethyl)phenyl]-1,5,3,7-dioxadiazocane, identified by its CAS number 77767-16-9, is a synthetic organic compound characterized by its unique dioxadiazocane structure. This compound features two 4-(trifluoromethyl)phenyl groups attached to a dioxadiazocane backbone, which contributes to its distinctive chemical properties. The presence of trifluoromethyl groups enhances its lipophilicity and may influence its reactivity and interaction with biological systems. The dioxadiazocane framework introduces a degree of rigidity and stability to the molecule, potentially affecting its solubility and melting point. This compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the trifluoromethyl groups, which can impact its behavior in various chemical reactions. While specific applications may vary, compounds with similar structures are often explored in fields such as materials science, pharmaceuticals, and agrochemicals for their potential utility in developing new materials or therapeutic agents. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₈H₁₆F₆N₂O₂

InChI: InChI=1/C18H16F6N2O2/c19-17(20,21)13-1-5-15(6-2-13)25-9-27-11-26(12-28-10-25)16-7-3-14(4-8-16)18(22,23)24/h1-8H,9-12H2

SMILES: c1cc(ccc1C(F)(F)F)N1COCN(COC1)c1ccc(cc1)C(F)(F)F