CAS 77778-73-5

(2-chlorophenyl)(4-nitrophenyl)methanone

Description:

(2-chlorophenyl)(4-nitrophenyl)methanone, with the CAS number 77778-73-5, is an organic compound characterized by its structure, which features a ketone functional group attached to two aromatic rings: a 2-chlorophenyl group and a 4-nitrophenyl group. This compound typically exhibits a solid state at room temperature and is likely to be pale yellow to yellow in color due to the presence of the nitro group, which can influence its electronic properties. The presence of both chlorine and nitro substituents on the phenyl rings can impart significant polarity and reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Its molecular structure suggests that it may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's stability and solubility characteristics would depend on the solvent used, and it may exhibit moderate to low solubility in common organic solvents. Safety data should be consulted for handling and disposal, as compounds with halogen and nitro groups can pose environmental and health risks.

Formula: C₁₃H₈ClNO₃

InChI: InChI=1/C13H8ClNO3/c14-12-4-2-1-3-11(12)13(16)9-5-7-10(8-6-9)15(17)18/h1-8H

SMILES: c1ccc(c(c1)C(=O)c1ccc(cc1)N(=O)=O)Cl