CymitQuimica logo

CAS 77779-51-2

:

2,5-Dihydro-2-(4-hydroxyphenyl)-3H-pyrazolo[4,3-c]quinolin-3-one

Description:
2,5-Dihydro-2-(4-hydroxyphenyl)-3H-pyrazolo[4,3-c]quinolin-3-one, with the CAS number 77779-51-2, is a heterocyclic organic compound characterized by its complex structure, which includes a pyrazoloquinoline framework. This compound features a hydroxyl group attached to a phenyl ring, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the hydroxyl group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its structural motifs that are often associated with pharmacological properties. Additionally, its unique arrangement of nitrogen and carbon atoms within the pyrazoloquinoline structure may impart specific electronic and steric characteristics, making it a candidate for further research in drug development or as a biochemical probe. However, detailed studies on its specific properties, such as melting point, boiling point, and spectral data, would be necessary for a comprehensive understanding of its behavior in various environments.
Formula:C16H11N3O2
InChI:InChI=1S/C16H11N3O2/c20-11-7-5-10(6-8-11)19-16(21)13-9-17-14-4-2-1-3-12(14)15(13)18-19/h1-9,17,20H
InChI key:InChIKey=VVAHIPUYFQMAOZ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C=3C(NC2)=CC=CC3)=NN1C4=CC=C(O)C=C4
Synonyms:
  • CGS 11361
  • 2,5-Dihydro-2-(4-hydroxyphenyl)-3H-pyrazolo[4,3-c]quinolin-3-one
  • 3H-Pyrazolo[4,3-c]quinolin-3-one, 2,5-dihydro-2-(4-hydroxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.