CAS 7778-85-0
:Propylene glycol dimethyl ether
Description:
Propylene glycol dimethyl ether, also known as PGDME, is an organic compound characterized by its ether functional group. It is a colorless, odorless liquid that is hygroscopic and has a low viscosity, making it an effective solvent for various applications. PGDME is known for its excellent solvency properties, particularly for polar and non-polar substances, which makes it useful in industries such as coatings, inks, and cleaning products. It has a relatively high boiling point and low volatility, contributing to its stability under various conditions. Additionally, PGDME is biodegradable and has a low toxicity profile, making it a safer alternative to some traditional solvents. Its chemical structure allows it to mix well with water and organic solvents, enhancing its versatility in formulations. Due to these characteristics, PGDME is often employed in formulations requiring a balance of solvency, stability, and environmental safety. However, as with any chemical, proper handling and safety precautions should be observed to mitigate any potential risks.
Formula:C5H12O2
InChI:InChI=1S/C5H12O2/c1-5(7-3)4-6-2/h5H,4H2,1-3H3
InChI key:InChIKey=LEEANUDEDHYDTG-UHFFFAOYSA-N
SMILES:C(COC)(OC)C
Synonyms:- Dmfdg
- Hisolve MMPOM
- Propane, 1,2-dimethoxy-
- Propylene Glycol Dimethyl Ether
- Propylene glycol dimethyl
- 1,2-Dimethoxypropane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,2-Dimethoxypropane
CAS:Formula:C5H12O2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:104.151,2-Dimethoxypropane
CAS:<p>1,2-Dimethoxypropane is a glycol ether that is used as a reaction solvent for cationic polymerization. It has been used as a cross-linking agent in coating and printing to form polymeric films. 1,2-Dimethoxypropane has also been used as a solid catalyst for the oxidation of alcohols and alkanes. This compound has been shown to be an effective hydrogen bond acceptor and donor, which can stabilize or destabilize protein structure. 1,2-Dimethoxypropane has an hydroxyl group that can react with other compounds to form ethers or esters. This compound is also a polar molecule that forms dipoles when it reacts with other polar molecules such as water or alcohols.</p>Formula:C5H12O2Purity:Min. 95%Molecular weight:104.15 g/mol


