CAS 777857-43-9

3-(1,1-Dimethylethyl)-5-methyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-propanoic acid

Description:

3-(1,1-Dimethylethyl)-5-methyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-propanoic acid, with CAS number 777857-43-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a furobenzopyran core. This compound features a propanoic acid functional group, contributing to its potential acidity and reactivity. The presence of a 1,1-dimethylethyl group and a methyl group indicates that it has branched alkyl substituents, which can influence its steric properties and solubility. The keto group at the 7-position enhances its reactivity, potentially allowing for various chemical transformations. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its unique structure suggests potential applications in fields such as medicinal chemistry, where understanding its interactions and stability under various conditions would be crucial for further development. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally.

Formula: C₁₉H₂₀O₅

InChI: InChI=1S/C19H20O5/c1-10-11(5-6-17(20)21)18(22)24-16-8-15-13(7-12(10)16)14(9-23-15)19(2,3)4/h7-9H,5-6H2,1-4H3,(H,20,21)

InChI key: InChIKey=RSZGOILSNWBLCB-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C=1C=2C(=CC3=C(C2)C(C)=C(CCC(O)=O)C(=O)O3)OC1

Synonyms:

• 3-(1,1-Dimethylethyl)-5-methyl-7-oxo-7H-furo[3,2-g][1]benzopyran-6-propanoic acid
• 7H-Furo[3,2-g][1]benzopyran-6-propanoic acid, 3-(1,1-dimethylethyl)-5-methyl-7-oxo-