
CAS 777857-46-2
:2,5-Dimethyl-7-oxo-3-phenyl-7H-furo[3,2-g][1]benzopyran-6-propanoic acid
Description:
2,5-Dimethyl-7-oxo-3-phenyl-7H-furo[3,2-g][1]benzopyran-6-propanoic acid, with the CAS number 777857-46-2, is a synthetic organic compound that belongs to the class of benzopyran derivatives. This compound features a complex fused ring structure, which includes a furobenzopyran moiety, contributing to its potential biological activity. It typically exhibits characteristics such as moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds with extensive aromatic systems. The presence of functional groups, including a carboxylic acid, influences its reactivity and potential interactions in biological systems. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in areas such as anti-inflammatory or antioxidant research, although specific biological activities would require empirical investigation. As with many synthetic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity.
Formula:C22H18O5
InChI:InChI=1S/C22H18O5/c1-12-15(8-9-20(23)24)22(25)27-18-11-19-17(10-16(12)18)21(13(2)26-19)14-6-4-3-5-7-14/h3-7,10-11H,8-9H2,1-2H3,(H,23,24)
InChI key:InChIKey=FSBPSGLXPOSHDW-UHFFFAOYSA-N
SMILES:CC1=C(C=2C(O1)=CC3=C(C2)C(C)=C(CCC(O)=O)C(=O)O3)C4=CC=CC=C4
Synonyms:- 7H-Furo[3,2-g][1]benzopyran-6-propanoic acid, 2,5-dimethyl-7-oxo-3-phenyl-
- 2,5-Dimethyl-7-oxo-3-phenyl-7H-furo[3,2-g][1]benzopyran-6-propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.