CAS 777857-47-3
:2,5,9-Trimethyl-7-oxo-3-phenyl-7H-furo[3,2-g][1]benzopyran-6-propanoic acid
Description:
2,5,9-Trimethyl-7-oxo-3-phenyl-7H-furo[3,2-g][1]benzopyran-6-propanoic acid, identified by its CAS number 777857-47-3, is a complex organic compound characterized by its unique fused ring structure that combines elements of furan and benzopyran. This compound features multiple functional groups, including a ketone and a carboxylic acid, which contribute to its reactivity and potential biological activity. The presence of the phenyl group enhances its aromatic character, while the trimethyl substituents provide steric hindrance, influencing its solubility and interaction with other molecules. Typically, compounds of this nature may exhibit properties such as antioxidant activity, making them of interest in pharmaceutical and biochemical research. Additionally, the structural complexity suggests potential applications in organic synthesis and material science. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise characterization.
Formula:C23H20O5
InChI:InChI=1S/C23H20O5/c1-12-16(9-10-19(24)25)23(26)28-21-13(2)22-18(11-17(12)21)20(14(3)27-22)15-7-5-4-6-8-15/h4-8,11H,9-10H2,1-3H3,(H,24,25)
InChI key:InChIKey=UODLKUHOWBRKDI-UHFFFAOYSA-N
SMILES:CC1=C(C=2C(=C(C)C3=C(C2)C(C)=C(CCC(O)=O)C(=O)O3)O1)C4=CC=CC=C4
Synonyms:- 2,5,9-Trimethyl-7-oxo-3-phenyl-7H-furo[3,2-g][1]benzopyran-6-propanoic acid
- 7H-Furo[3,2-g][1]benzopyran-6-propanoic acid, 2,5,9-trimethyl-7-oxo-3-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.